C29H32O7 — CID 71754432
(4S,12E)-22-methoxy-20-(2-methoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71754432) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is (4S,12E)-22-methoxy-20-(2-methoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,12E)-22-methoxy-20-(2-methoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71754432 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (4S,12E)-22-methoxy-20-(2-methoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1ccccc1C1CC(=O)Oc2cc3c(c(OC)c21)C(=O)O[C@@H](C)CCCC(=O)CCC/C=C/3 |
| InChI | InChI=1S/C29H32O7/c1-18-10-9-13-20(30)12-6-4-5-11-19-16-24-27(28(34-3)26(19)29(32)35-18)22(17-25(31)36-24)21-14-7-8-15-23(21)33-2/h5,7-8,11,14-16,18,22H,4,6,9-10,12-13,17H2,1-3H3/b11-5+/t18-,22?/m0/s1 |
| InChIKey | MXWBUYXEGQEVJQ-XAQRQLDISA-N |
| XLogP | 5.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|