C31H30O6 — CID 75464625
(4S,12E)-22-hydroxy-4-methyl-20-naphthalen-1-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 75464625) has the molecular formula C31H30O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is (4S,12E)-22-hydroxy-4-methyl-20-naphthalen-1-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,12E)-22-hydroxy-4-methyl-20-naphthalen-1-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 75464625 |
| Molecular Formula | C31H30O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (4S,12E)-22-hydroxy-4-methyl-20-naphthalen-1-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@H]1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)C(c1cccc2ccccc12)CC(=O)O3 |
| InChI | InChI=1S/C31H30O6/c1-19-9-7-14-22(32)13-4-2-3-11-21-17-26-29(30(34)28(21)31(35)36-19)25(18-27(33)37-26)24-16-8-12-20-10-5-6-15-23(20)24/h3,5-6,8,10-12,15-17,19,25,34H,2,4,7,9,13-14,18H2,1H3/b11-3+/t19-,25?/m0/s1 |
| InChIKey | BAIGPTHTFBKKCQ-FDGLIQBESA-N |
| XLogP | 6.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|