C31H31NO7 — CID 96544280
(4R,12E,20S)-22-hydroxy-4-methyl-20-(1-methyl-2-oxoquinolin-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544280) has the molecular formula C31H31NO7 and a molecular weight of 529.59 g/mol. Its IUPAC name is (4R,12E,20S)-22-hydroxy-4-methyl-20-(1-methyl-2-oxoquinolin-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4R,12E,20S)-22-hydroxy-4-methyl-20-(1-methyl-2-oxoquinolin-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544280 |
| Molecular Formula | C31H31NO7 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | (4R,12E,20S)-22-hydroxy-4-methyl-20-(1-methyl-2-oxoquinolin-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@@H]1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)[C@@H](c1cc2ccccc2n(C)c1=O)CC(=O)O3 |
| InChI | InChI=1S/C31H31NO7/c1-18-9-8-13-21(33)12-5-3-4-11-20-16-25-28(29(35)27(20)31(37)38-18)22(17-26(34)39-25)23-15-19-10-6-7-14-24(19)32(2)30(23)36/h4,6-7,10-11,14-16,18,22,35H,3,5,8-9,12-13,17H2,1-2H3/b11-4+/t18-,22-/m1/s1 |
| InChIKey | FTVNIFJUUJWBRF-UUZZHQQOSA-N |
| XLogP | 5.17 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|