C32H32O7 — CID 96544566
(4S,20S)-22-hydroxy-20-(4-methoxynaphthalen-1-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544566) has the molecular formula C32H32O7 and a molecular weight of 528.60 g/mol. Its IUPAC name is (4S,20S)-22-hydroxy-20-(4-methoxynaphthalen-1-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,20S)-22-hydroxy-20-(4-methoxynaphthalen-1-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544566 |
| Molecular Formula | C32H32O7 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (4S,20S)-22-hydroxy-20-(4-methoxynaphthalen-1-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3cc4c(c(O)c32)C(=O)O[C@@H](C)CCCC(=O)CCCC=C4)c2ccccc12 |
| InChI | InChI=1S/C32H32O7/c1-19-9-8-12-21(33)11-5-3-4-10-20-17-27-30(31(35)29(20)32(36)38-19)25(18-28(34)39-27)23-15-16-26(37-2)24-14-7-6-13-22(23)24/h4,6-7,10,13-17,19,25,35H,3,5,8-9,11-12,18H2,1-2H3/t19-,25-/m0/s1 |
| InChIKey | ZHIXGGYXRAFOHY-DFBJGRDBSA-N |
| XLogP | 6.48 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|