C29H32O8 — CID 71827498
(4S)-20-(3,5-dimethoxyphenyl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71827498) has the molecular formula C29H32O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is (4S)-20-(3,5-dimethoxyphenyl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S)-20-(3,5-dimethoxyphenyl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71827498 |
| Molecular Formula | C29H32O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (4S)-20-(3,5-dimethoxyphenyl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1cc(OC)cc(C2CC(=O)Oc3cc4c(c(O)c32)C(=O)O[C@@H](C)CCCC(=O)CCCC=C4)c1 |
| InChI | InChI=1S/C29H32O8/c1-17-8-7-11-20(30)10-6-4-5-9-18-14-24-27(28(32)26(18)29(33)36-17)23(16-25(31)37-24)19-12-21(34-2)15-22(13-19)35-3/h5,9,12-15,17,23,32H,4,6-8,10-11,16H2,1-3H3/t17-,23?/m0/s1 |
| InChIKey | NHAQHRLBIKEAKD-NVHKAFQKSA-N |
| XLogP | 5.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|