C29H32O9 — CID 71827467
(4S)-22-hydroxy-20-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71827467) has the molecular formula C29H32O9 and a molecular weight of 524.57 g/mol. Its IUPAC name is (4S)-22-hydroxy-20-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S)-22-hydroxy-20-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71827467 |
| Molecular Formula | C29H32O9 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | (4S)-22-hydroxy-20-(4-hydroxy-3,5-dimethoxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1cc(C2CC(=O)Oc3cc4c(c(O)c32)C(=O)O[C@@H](C)CCCC(=O)CCCC=C4)cc(OC)c1O |
| InChI | InChI=1S/C29H32O9/c1-16-8-7-11-19(30)10-6-4-5-9-17-12-21-26(28(33)25(17)29(34)37-16)20(15-24(31)38-21)18-13-22(35-2)27(32)23(14-18)36-3/h5,9,12-14,16,20,32-33H,4,6-8,10-11,15H2,1-3H3/t16-,20?/m0/s1 |
| InChIKey | WGJOSLQQHQYNBP-DJZRFWRSSA-N |
| XLogP | 5.04 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|