C27H28O7 — CID 96544883
(4S,12E,20R)-22-hydroxy-20-(4-hydroxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544883) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is (4S,12E,20R)-22-hydroxy-20-(4-hydroxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,12E,20R)-22-hydroxy-20-(4-hydroxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544883 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (4S,12E,20R)-22-hydroxy-20-(4-hydroxyphenyl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@H]1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)[C@@H](c1ccc(O)cc1)CC(=O)O3 |
| InChI | InChI=1S/C27H28O7/c1-16-6-5-9-19(28)8-4-2-3-7-18-14-22-25(26(31)24(18)27(32)33-16)21(15-23(30)34-22)17-10-12-20(29)13-11-17/h3,7,10-14,16,21,29,31H,2,4-6,8-9,15H2,1H3/b7-3+/t16-,21+/m0/s1 |
| InChIKey | JXQFZIFQZZUTOS-OPRQZIHKSA-N |
| XLogP | 5.02 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|