C30H34O9 — CID 96544184
(4S,20R)-22-hydroxy-4-methyl-20-(3,4,5-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544184) has the molecular formula C30H34O9 and a molecular weight of 538.59 g/mol. Its IUPAC name is (4S,20R)-22-hydroxy-4-methyl-20-(3,4,5-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,20R)-22-hydroxy-4-methyl-20-(3,4,5-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544184 |
| Molecular Formula | C30H34O9 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (4S,20R)-22-hydroxy-4-methyl-20-(3,4,5-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1cc([C@H]2CC(=O)Oc3cc4c(c(O)c32)C(=O)O[C@@H](C)CCCC(=O)CCCC=C4)cc(OC)c1OC |
| InChI | InChI=1S/C30H34O9/c1-17-9-8-12-20(31)11-7-5-6-10-18-13-22-27(28(33)26(18)30(34)38-17)21(16-25(32)39-22)19-14-23(35-2)29(37-4)24(15-19)36-3/h6,10,13-15,17,21,33H,5,7-9,11-12,16H2,1-4H3/t17-,21+/m0/s1 |
| InChIKey | QMLCJALFRIQKMK-LAUBAEHRSA-N |
| XLogP | 5.34 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|