C30H34O8 — CID 163084402
20-(3,5-dimethoxyphenyl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 163084402) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is 20-(3,5-dimethoxyphenyl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | 20-(3,5-dimethoxyphenyl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 163084402 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 20-(3,5-dimethoxyphenyl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1cc(OC)cc(C2CC(=O)Oc3cc4c(c(OC)c32)C(=O)OC(C)CCCC(=O)CCCC=C4)c1 |
| InChI | InChI=1S/C30H34O8/c1-18-9-8-12-21(31)11-7-5-6-10-19-15-25-28(29(36-4)27(19)30(33)37-18)24(17-26(32)38-25)20-13-22(34-2)16-23(14-20)35-3/h6,10,13-16,18,24H,5,7-9,11-12,17H2,1-4H3 |
| InChIKey | WWDYCOGKPCWXLX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|