C31H36O9 — CID 96544300
(4R,20R)-22-methoxy-4-methyl-20-(2,3,4-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544300) has the molecular formula C31H36O9 and a molecular weight of 552.62 g/mol. Its IUPAC name is (4R,20R)-22-methoxy-4-methyl-20-(2,3,4-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4R,20R)-22-methoxy-4-methyl-20-(2,3,4-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544300 |
| Molecular Formula | C31H36O9 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (4R,20R)-22-methoxy-4-methyl-20-(2,3,4-trimethoxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1ccc([C@H]2CC(=O)Oc3cc4c(c(OC)c32)C(=O)O[C@H](C)CCCC(=O)CCCC=C4)c(OC)c1OC |
| InChI | InChI=1S/C31H36O9/c1-18-10-9-13-20(32)12-8-6-7-11-19-16-24-27(30(38-5)26(19)31(34)39-18)22(17-25(33)40-24)21-14-15-23(35-2)29(37-4)28(21)36-3/h7,11,14-16,18,22H,6,8-10,12-13,17H2,1-5H3/t18-,22-/m1/s1 |
| InChIKey | NYQVJYMQTWOVDD-XMSQKQJNSA-N |
| XLogP | 5.64 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|