C33H35NO8 — CID 96544289
(4S,20S)-22-methoxy-20-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544289) has the molecular formula C33H35NO8 and a molecular weight of 573.64 g/mol. Its IUPAC name is (4S,20S)-22-methoxy-20-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,20S)-22-methoxy-20-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544289 |
| Molecular Formula | C33H35NO8 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | (4S,20S)-22-methoxy-20-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1ccc2cc([C@H]3CC(=O)Oc4cc5c(c(OC)c43)C(=O)O[C@@H](C)CCCC(=O)CCCC=C5)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C33H35NO8/c1-19-9-8-12-22(35)11-7-5-6-10-21-16-27-30(31(40-4)29(21)33(38)41-19)24(18-28(36)42-27)25-15-20-13-14-23(39-3)17-26(20)34(2)32(25)37/h6,10,13-17,19,24H,5,7-9,11-12,18H2,1-4H3/t19-,24+/m0/s1 |
| InChIKey | DUCVBOCIKGCNTD-YADARESESA-N |
| XLogP | 5.48 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|