C29H30O8 — CID 96544605
(4S,12E,20R)-20-(1,3-benzodioxol-5-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544605) has the molecular formula C29H30O8 and a molecular weight of 506.55 g/mol. Its IUPAC name is (4S,12E,20R)-20-(1,3-benzodioxol-5-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,12E,20R)-20-(1,3-benzodioxol-5-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544605 |
| Molecular Formula | C29H30O8 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | (4S,12E,20R)-20-(1,3-benzodioxol-5-yl)-22-methoxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1c2c(cc3c1[C@@H](c1ccc4c(c1)OCO4)CC(=O)O3)/C=C/CCCC(=O)CCC[C@H](C)OC2=O |
| InChI | InChI=1S/C29H30O8/c1-17-7-6-10-20(30)9-5-3-4-8-19-14-24-27(28(33-2)26(19)29(32)36-17)21(15-25(31)37-24)18-11-12-22-23(13-18)35-16-34-22/h4,8,11-14,17,21H,3,5-7,9-10,15-16H2,1-2H3/b8-4+/t17-,21+/m0/s1 |
| InChIKey | RATAOJLOWRVVRU-LIEUZMQSSA-N |
| XLogP | 5.35 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|