C31H36O7 — CID 163086828
22-methoxy-4-methyl-20-(4-propan-2-yloxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 163086828) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is 22-methoxy-4-methyl-20-(4-propan-2-yloxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | 22-methoxy-4-methyl-20-(4-propan-2-yloxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 163086828 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 22-methoxy-4-methyl-20-(4-propan-2-yloxyphenyl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1c2c(cc3c1C(c1ccc(OC(C)C)cc1)CC(=O)O3)C=CCCCC(=O)CCCC(C)OC2=O |
| InChI | InChI=1S/C31H36O7/c1-19(2)36-24-15-13-21(14-16-24)25-18-27(33)38-26-17-22-10-6-5-7-11-23(32)12-8-9-20(3)37-31(34)28(22)30(35-4)29(25)26/h6,10,13-17,19-20,25H,5,7-9,11-12,18H2,1-4H3 |
| InChIKey | MLVUAYINBSEVTC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|