C37H40O8 — CID 163087232
22-methoxy-20-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 163087232) has the molecular formula C37H40O8 and a molecular weight of 612.72 g/mol. Its IUPAC name is 22-methoxy-20-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | 22-methoxy-20-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 163087232 |
| Molecular Formula | C37H40O8 |
| Molecular Weight | 612.72 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 22-methoxy-20-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | COc1ccc(CCOc2ccc(C3CC(=O)Oc4cc5c(c(OC)c43)C(=O)OC(C)CCCC(=O)CCCC=C5)cc2)cc1 |
| InChI | InChI=1S/C37H40O8/c1-24-8-7-11-28(38)10-6-4-5-9-27-22-32-35(36(42-3)34(27)37(40)44-24)31(23-33(39)45-32)26-14-18-30(19-15-26)43-21-20-25-12-16-29(41-2)17-13-25/h5,9,12-19,22,24,31H,4,6-8,10-11,20-21,23H2,1-3H3 |
| InChIKey | LOATVDFDJZVZRM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.72 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|