C29H31NO8 — CID 96544847
2-[4-[(4S,12E,20S)-22-hydroxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]phenoxy]acetamide (PubChem CID 96544847) has the molecular formula C29H31NO8 and a molecular weight of 521.57 g/mol. Its IUPAC name is 2-[4-[(4S,12E,20S)-22-hydroxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]phenoxy]acetamide.
| Compound Name | 2-[4-[(4S,12E,20S)-22-hydroxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 96544847 |
| Molecular Formula | C29H31NO8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[4-[(4S,12E,20S)-22-hydroxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]phenoxy]acetamide |
| SMILES | C[C@H]1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)[C@H](c1ccc(OCC(N)=O)cc1)CC(=O)O3 |
| InChI | InChI=1S/C29H31NO8/c1-17-6-5-9-20(31)8-4-2-3-7-19-14-23-27(28(34)26(19)29(35)37-17)22(15-25(33)38-23)18-10-12-21(13-11-18)36-16-24(30)32/h3,7,10-14,17,22,34H,2,4-6,8-9,15-16H2,1H3,(H2,30,32)/b7-3+/t17-,22-/m0/s1 |
| InChIKey | KBQNUFNFMJFKDJ-LCRIEDMNSA-N |
| XLogP | 4.18 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|