C30H29NO6 — CID 71753892
(12E)-22-hydroxy-4-methyl-20-quinolin-6-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71753892) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is (12E)-22-hydroxy-4-methyl-20-quinolin-6-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (12E)-22-hydroxy-4-methyl-20-quinolin-6-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71753892 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (12E)-22-hydroxy-4-methyl-20-quinolin-6-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | CC1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)C(c1ccc2ncccc2c1)CC(=O)O3 |
| InChI | InChI=1S/C30H29NO6/c1-18-7-5-11-22(32)10-4-2-3-8-21-16-25-28(29(34)27(21)30(35)36-18)23(17-26(33)37-25)19-12-13-24-20(15-19)9-6-14-31-24/h3,6,8-9,12-16,18,23,34H,2,4-5,7,10-11,17H2,1H3/b8-3+ |
| InChIKey | ANCJBVFGWXAAGZ-FPYGCLRLSA-N |
| XLogP | 5.86 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|