C25H26O6S — CID 96544612
(4R,12E,20S)-22-hydroxy-4-methyl-20-thiophen-3-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544612) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is (4R,12E,20S)-22-hydroxy-4-methyl-20-thiophen-3-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4R,12E,20S)-22-hydroxy-4-methyl-20-thiophen-3-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544612 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (4R,12E,20S)-22-hydroxy-4-methyl-20-thiophen-3-yl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@@H]1CCCC(=O)CCC/C=C/c2cc3c(c(O)c2C(=O)O1)[C@@H](c1ccsc1)CC(=O)O3 |
| InChI | InChI=1S/C25H26O6S/c1-15-6-5-9-18(26)8-4-2-3-7-16-12-20-23(24(28)22(16)25(29)30-15)19(13-21(27)31-20)17-10-11-32-14-17/h3,7,10-12,14-15,19,28H,2,4-6,8-9,13H2,1H3/b7-3+/t15-,19-/m1/s1 |
| InChIKey | XRHQUVWGGSCSKX-ASEPJHSNSA-N |
| XLogP | 5.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|