C25H26O7 — CID 162853693
(4R,20R)-20-(furan-2-yl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 162853693) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is (4R,20R)-20-(furan-2-yl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4R,20R)-20-(furan-2-yl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 162853693 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (4R,20R)-20-(furan-2-yl)-22-hydroxy-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@@H]1CCCC(=O)CCCC=Cc2cc3c(c(O)c2C(=O)O1)[C@H](c1ccco1)CC(=O)O3 |
| InChI | InChI=1S/C25H26O7/c1-15-7-5-10-17(26)9-4-2-3-8-16-13-20-23(24(28)22(16)25(29)31-15)18(14-21(27)32-20)19-11-6-12-30-19/h3,6,8,11-13,15,18,28H,2,4-5,7,9-10,14H2,1H3/t15-,18+/m1/s1 |
| InChIKey | RWCVMLCYBFWAQS-QAPCUYQASA-N |
| XLogP | 4.91 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|