C31H30O7 — CID 71827492
(4S)-22-hydroxy-4-methyl-20-(5-phenylfuran-2-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 71827492) has the molecular formula C31H30O7 and a molecular weight of 514.57 g/mol. Its IUPAC name is (4S)-22-hydroxy-4-methyl-20-(5-phenylfuran-2-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S)-22-hydroxy-4-methyl-20-(5-phenylfuran-2-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 71827492 |
| Molecular Formula | C31H30O7 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | (4S)-22-hydroxy-4-methyl-20-(5-phenylfuran-2-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@H]1CCCC(=O)CCCC=Cc2cc3c(c(O)c2C(=O)O1)C(c1ccc(-c2ccccc2)o1)CC(=O)O3 |
| InChI | InChI=1S/C31H30O7/c1-19-9-8-14-22(32)13-7-3-6-12-21-17-26-29(30(34)28(21)31(35)36-19)23(18-27(33)38-26)25-16-15-24(37-25)20-10-4-2-5-11-20/h2,4-6,10-12,15-17,19,23,34H,3,7-9,13-14,18H2,1H3/t19-,23?/m0/s1 |
| InChIKey | VLXUIGXOVLBJAX-HSTJUUNISA-N |
| XLogP | 6.57 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|