C34H34O9 — CID 71827427
methyl 4-[5-[(4S)-22-methoxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]furan-2-yl]benzoate (PubChem CID 71827427) has the molecular formula C34H34O9 and a molecular weight of 586.64 g/mol. Its IUPAC name is methyl 4-[5-[(4S)-22-methoxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(4S)-22-methoxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 71827427 |
| Molecular Formula | C34H34O9 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | methyl 4-[5-[(4S)-22-methoxy-4-methyl-2,8,18-trioxo-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraen-20-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C3CC(=O)Oc4cc5c(c(OC)c43)C(=O)O[C@@H](C)CCCC(=O)CCCC=C5)o2)cc1 |
| InChI | InChI=1S/C34H34O9/c1-20-8-7-11-24(35)10-6-4-5-9-23-18-28-31(32(39-2)30(23)34(38)41-20)25(19-29(36)43-28)27-17-16-26(42-27)21-12-14-22(15-13-21)33(37)40-3/h5,9,12-18,20,25H,4,6-8,10-11,19H2,1-3H3/t20-,25?/m0/s1 |
| InChIKey | GMADKHGVOPWNPI-JINQPTGOSA-N |
| XLogP | 6.66 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|