C33H38O8 — CID 96544792
(4S,20R)-22-methoxy-20-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 96544792) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is (4S,20R)-22-methoxy-20-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S,20R)-22-methoxy-20-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 96544792 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (4S,20R)-22-methoxy-20-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-4-methyl-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C=C(C)COc1ccc([C@H]2CC(=O)Oc3cc4c(c(OC)c32)C(=O)O[C@@H](C)CCCC(=O)CCCC=C4)cc1OC |
| InChI | InChI=1S/C33H38O8/c1-20(2)19-39-26-15-14-22(16-27(26)37-4)25-18-29(35)41-28-17-23-11-7-6-8-12-24(34)13-9-10-21(3)40-33(36)30(23)32(38-5)31(25)28/h7,11,14-17,21,25H,1,6,8-10,12-13,18-19H2,2-5H3/t21-,25+/m0/s1 |
| InChIKey | RCGXLXCDPDRLSJ-SQJMNOBHSA-N |
| XLogP | 6.58 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|