C33H33NO7 — CID 131665248
(4S)-22-hydroxy-4-methyl-20-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione (PubChem CID 131665248) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4S)-22-hydroxy-4-methyl-20-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione.
| Compound Name | (4S)-22-hydroxy-4-methyl-20-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
|---|---|
| PubChem CID | 131665248 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (4S)-22-hydroxy-4-methyl-20-(2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-3-yl)-3,17-dioxatricyclo[12.8.0.016,21]docosa-1(22),12,14,16(21)-tetraene-2,8,18-trione |
| SMILES | C[C@H]1CCCC(=O)CCCC=Cc2cc3c(c(O)c2C(=O)O1)C(c1cc2cccc4c2n(c1=O)CCC4)CC(=O)O3 |
| InChI | InChI=1S/C33H33NO7/c1-19-8-5-14-23(35)13-4-2-3-9-21-17-26-29(31(37)28(21)33(39)40-19)24(18-27(36)41-26)25-16-22-11-6-10-20-12-7-15-34(30(20)22)32(25)38/h3,6,9-11,16-17,19,24,37H,2,4-5,7-8,12-15,18H2,1H3/t19-,24?/m0/s1 |
| InChIKey | STERZSQPCMBDAR-XGLRFROISA-N |
| XLogP | 5.58 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|