C20H16O5 — CID 97046015
(10R)-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione (PubChem CID 97046015) has the molecular formula C20H16O5 and a molecular weight of 336.34 g/mol. Its IUPAC name is (10R)-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione.
| Compound Name | (10R)-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 97046015 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | (10R)-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
| SMILES | COc1ccccc1[C@H]1CC(=O)Oc2ccc3c(C)cc(=O)oc3c21 |
| InChI | InChI=1S/C20H16O5/c1-11-9-17(21)25-20-12(11)7-8-16-19(20)14(10-18(22)24-16)13-5-3-4-6-15(13)23-2/h3-9,14H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | HJQXHCGCMOEFLH-CQSZACIVSA-N |
| XLogP | 3.55 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|