C22H18O7 — CID 99985297
(10R)-6-acetyl-5-hydroxy-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 99985297) has the molecular formula C22H18O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is (10R)-6-acetyl-5-hydroxy-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | (10R)-6-acetyl-5-hydroxy-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 99985297 |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (10R)-6-acetyl-5-hydroxy-10-(2-methoxyphenyl)-4-methyl-9,10-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1ccccc1[C@H]1CC(=O)Oc2c(C(C)=O)c(O)c3c(C)cc(=O)oc3c21 |
| InChI | InChI=1S/C22H18O7/c1-10-8-15(24)28-21-17(10)20(26)18(11(2)23)22-19(21)13(9-16(25)29-22)12-6-4-5-7-14(12)27-3/h4-8,13,26H,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | GFETVUKXKJCUSK-CYBMUJFWSA-N |
| XLogP | 3.46 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|