C23H19NO8 — CID 99999071
2-[3-[(10S)-6-acetyl-5-hydroxy-4-methyl-2,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetamide (PubChem CID 99999071) has the molecular formula C23H19NO8 and a molecular weight of 437.40 g/mol. Its IUPAC name is 2-[3-[(10S)-6-acetyl-5-hydroxy-4-methyl-2,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetamide.
| Compound Name | 2-[3-[(10S)-6-acetyl-5-hydroxy-4-methyl-2,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 99999071 |
| Molecular Formula | C23H19NO8 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[3-[(10S)-6-acetyl-5-hydroxy-4-methyl-2,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetamide |
| SMILES | CC(=O)c1c2c(c3oc(=O)cc(C)c3c1O)[C@H](c1cccc(OCC(N)=O)c1)CC(=O)O2 |
| InChI | InChI=1S/C23H19NO8/c1-10-6-16(27)31-22-18(10)21(29)19(11(2)25)23-20(22)14(8-17(28)32-23)12-4-3-5-13(7-12)30-9-15(24)26/h3-7,14,29H,8-9H2,1-2H3,(H2,24,26)/t14-/m0/s1 |
| InChIKey | ZXXFSZFIBNSSGV-AWEZNQCLSA-N |
| XLogP | 2.31 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|