C24H19NO7 — CID 163355821
6-hydroxy-10-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione (PubChem CID 163355821) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is 6-hydroxy-10-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione.
| Compound Name | 6-hydroxy-10-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 163355821 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 6-hydroxy-10-(7-methoxy-1-methyl-2-oxoquinolin-3-yl)-4-methyl-9,10-dihydropyrano[2,3-f]chromene-2,8-dione |
| SMILES | COc1ccc2cc(C3CC(=O)Oc4c(O)cc5c(C)cc(=O)oc5c43)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C24H19NO7/c1-11-6-19(27)31-22-14(11)9-18(26)23-21(22)15(10-20(28)32-23)16-7-12-4-5-13(30-3)8-17(12)25(2)24(16)29/h4-9,15,26H,10H2,1-3H3 |
| InChIKey | FQMYZWGONAJSHR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|