C15H13NO6 — CID 54705973
4-hydroxy-8,9-dimethoxy-6-methylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 54705973) has the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. Its IUPAC name is 4-hydroxy-8,9-dimethoxy-6-methylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-hydroxy-8,9-dimethoxy-6-methylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 54705973 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-hydroxy-8,9-dimethoxy-6-methylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | COc1cc2c3oc(=O)cc(O)c3c(=O)n(C)c2cc1OC |
| InChI | InChI=1S/C15H13NO6/c1-16-8-5-11(21-3)10(20-2)4-7(8)14-13(15(16)19)9(17)6-12(18)22-14/h4-6,17H,1-3H3 |
| InChIKey | YARDENOWODKYIV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|