C18H15NO4 — CID 2794540
3,9-dimethoxy-5-methyl-[1]benzofuro[3,2-c]quinolin-6-one (PubChem CID 2794540) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3,9-dimethoxy-5-methyl-[1]benzofuro[3,2-c]quinolin-6-one.
| Compound Name | 3,9-dimethoxy-5-methyl-[1]benzofuro[3,2-c]quinolin-6-one |
|---|---|
| PubChem CID | 2794540 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3,9-dimethoxy-5-methyl-[1]benzofuro[3,2-c]quinolin-6-one |
| SMILES | COc1ccc2c(c1)oc1c3ccc(OC)cc3n(C)c(=O)c21 |
| InChI | InChI=1S/C18H15NO4/c1-19-14-8-10(21-2)4-6-12(14)17-16(18(19)20)13-7-5-11(22-3)9-15(13)23-17/h4-9H,1-3H3 |
| InChIKey | SBEKYZCFCAIVOB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |