C14H13NO4 — CID 132587331
methyl 6-methoxy-4-methylfuro[3,2-b]indole-2-carboxylate (PubChem CID 132587331) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl 6-methoxy-4-methylfuro[3,2-b]indole-2-carboxylate.
| Compound Name | methyl 6-methoxy-4-methylfuro[3,2-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 132587331 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl 6-methoxy-4-methylfuro[3,2-b]indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(o1)c1ccc(OC)cc1n2C |
| InChI | InChI=1S/C14H13NO4/c1-15-10-6-8(17-2)4-5-9(10)13-11(15)7-12(19-13)14(16)18-3/h4-7H,1-3H3 |
| InChIKey | OUOFEOJTSGIQGR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |