C12H12N2O5 — CID 117263069
2-(7-methoxy-1-methyl-2,4-dioxoquinazolin-3-yl)acetic acid (PubChem CID 117263069) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-(7-methoxy-1-methyl-2,4-dioxoquinazolin-3-yl)acetic acid.
| Compound Name | 2-(7-methoxy-1-methyl-2,4-dioxoquinazolin-3-yl)acetic acid |
|---|---|
| PubChem CID | 117263069 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-(7-methoxy-1-methyl-2,4-dioxoquinazolin-3-yl)acetic acid |
| SMILES | COc1ccc2c(=O)n(CC(=O)O)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C12H12N2O5/c1-13-9-5-7(19-2)3-4-8(9)11(17)14(12(13)18)6-10(15)16/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | XADVYKBKSSVYLO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |