C29H27NO5 — CID 23627235
2-[2-[4-(6-methoxynaphthalen-2-yl)oxybutoxy]carbazol-9-yl]acetic acid (PubChem CID 23627235) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxynaphthalen-2-yl)oxybutoxy]carbazol-9-yl]acetic acid.
| Compound Name | 2-[2-[4-(6-methoxynaphthalen-2-yl)oxybutoxy]carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 23627235 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[2-[4-(6-methoxynaphthalen-2-yl)oxybutoxy]carbazol-9-yl]acetic acid |
| SMILES | COc1ccc2cc(OCCCCOc3ccc4c5ccccc5n(CC(=O)O)c4c3)ccc2c1 |
| InChI | InChI=1S/C29H27NO5/c1-33-22-10-8-21-17-23(11-9-20(21)16-22)34-14-4-5-15-35-24-12-13-26-25-6-2-3-7-27(25)30(19-29(31)32)28(26)18-24/h2-3,6-13,16-18H,4-5,14-15,19H2,1H3,(H,31,32) |
| InChIKey | BVTKKTOCXBAZDL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|