C27H25NO5 — CID 23627349
2-[2-[4-[(3-oxo-1,2-dihydroinden-5-yl)oxy]butoxy]carbazol-9-yl]acetic acid (PubChem CID 23627349) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[2-[4-[(3-oxo-1,2-dihydroinden-5-yl)oxy]butoxy]carbazol-9-yl]acetic acid.
| Compound Name | 2-[2-[4-[(3-oxo-1,2-dihydroinden-5-yl)oxy]butoxy]carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 23627349 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[2-[4-[(3-oxo-1,2-dihydroinden-5-yl)oxy]butoxy]carbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2ccccc2c2ccc(OCCCCOc3ccc4c(c3)C(=O)CC4)cc21 |
| InChI | InChI=1S/C27H25NO5/c29-26-12-8-18-7-9-19(15-23(18)26)32-13-3-4-14-33-20-10-11-22-21-5-1-2-6-24(21)28(17-27(30)31)25(22)16-20/h1-2,5-7,9-11,15-16H,3-4,8,12-14,17H2,(H,30,31) |
| InChIKey | FLLSYEJJCSGZSY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|