C16H17NO4Y — CID 157189840
2-[2-(hydroxymethoxy)carbazol-9-yl]acetic acid;methane;yttrium (PubChem CID 157189840) has the molecular formula C16H17NO4Y and a molecular weight of 376.22 g/mol. Its IUPAC name is 2-[2-(hydroxymethoxy)carbazol-9-yl]acetic acid;methane;yttrium.
| Compound Name | 2-[2-(hydroxymethoxy)carbazol-9-yl]acetic acid;methane;yttrium |
|---|---|
| PubChem CID | 157189840 |
| Molecular Formula | C16H17NO4Y |
| Molecular Weight | 376.22 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 2-[2-(hydroxymethoxy)carbazol-9-yl]acetic acid;methane;yttrium |
| SMILES | C.O=C(O)Cn1c2ccccc2c2ccc(OCO)cc21.[Y] |
| InChI | InChI=1S/C15H13NO4.CH4.Y/c17-9-20-10-5-6-12-11-3-1-2-4-13(11)16(8-15(18)19)14(12)7-10;;/h1-7,17H,8-9H2,(H,18,19);1H4; |
| InChIKey | WTSICESAUCMXAP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|