C30H26N2O4 — CID 58948679
2-[2-[5-(6-cyanonaphthalen-2-yl)oxypentoxy]carbazol-9-yl]acetic acid (PubChem CID 58948679) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[2-[5-(6-cyanonaphthalen-2-yl)oxypentoxy]carbazol-9-yl]acetic acid.
| Compound Name | 2-[2-[5-(6-cyanonaphthalen-2-yl)oxypentoxy]carbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 58948679 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[2-[5-(6-cyanonaphthalen-2-yl)oxypentoxy]carbazol-9-yl]acetic acid |
| SMILES | N#Cc1ccc2cc(OCCCCCOc3ccc4c5ccccc5n(CC(=O)O)c4c3)ccc2c1 |
| InChI | InChI=1S/C30H26N2O4/c31-19-21-8-9-23-17-24(11-10-22(23)16-21)35-14-4-1-5-15-36-25-12-13-27-26-6-2-3-7-28(26)32(20-30(33)34)29(27)18-25/h2-3,6-13,16-18H,1,4-5,14-15,20H2,(H,33,34) |
| InChIKey | LQLRVBLUAXOLHU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|