C16H10O5 — CID 131750884
9-hydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 131750884) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 9-hydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 9-hydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 131750884 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 9-hydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | COc1ccc2c(c1)oc(=O)c1c3ccc(O)cc3oc21 |
| InChI | InChI=1S/C16H10O5/c1-19-9-3-5-11-13(7-9)21-16(18)14-10-4-2-8(17)6-12(10)20-15(11)14/h2-7,17H,1H3 |
| InChIKey | YQBVKPREVBFWSA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|