C17H12O6 — CID 73387965
3-ethoxy-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 73387965) has the molecular formula C17H12O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-ethoxy-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 3-ethoxy-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 73387965 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 3-ethoxy-8,9-dihydroxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | CCOc1ccc2c(c1)oc(=O)c1c3cc(O)c(O)cc3oc21 |
| InChI | InChI=1S/C17H12O6/c1-2-21-8-3-4-9-13(5-8)23-17(20)15-10-6-11(18)12(19)7-14(10)22-16(9)15/h3-7,18-19H,2H2,1H3 |
| InChIKey | DRPJWNOENCGJMD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|