C21H16O6 — CID 2931798
9-(4-ethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one (PubChem CID 2931798) has the molecular formula C21H16O6 and a molecular weight of 364.35 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one.
| Compound Name | 9-(4-ethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
|---|---|
| PubChem CID | 2931798 |
| Molecular Formula | C21H16O6 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 9-(4-ethoxyphenyl)-2,6,7-trihydroxyxanthen-3-one |
| SMILES | CCOc1ccc(-c2c3cc(O)c(=O)cc-3oc3cc(O)c(O)cc23)cc1 |
| InChI | InChI=1S/C21H16O6/c1-2-26-12-5-3-11(4-6-12)21-13-7-15(22)17(24)9-19(13)27-20-10-18(25)16(23)8-14(20)21/h3-10,22-24H,2H2,1H3 |
| InChIKey | FCOODAKSLRQBIM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|