C21H22O5 — CID 174788047
5,7-diethoxy-2-(4-ethoxyphenyl)chromen-4-one (PubChem CID 174788047) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is 5,7-diethoxy-2-(4-ethoxyphenyl)chromen-4-one.
| Compound Name | 5,7-diethoxy-2-(4-ethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 174788047 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 5,7-diethoxy-2-(4-ethoxyphenyl)chromen-4-one |
| SMILES | CCOc1ccc(-c2cc(=O)c3c(OCC)cc(OCC)cc3o2)cc1 |
| InChI | InChI=1S/C21H22O5/c1-4-23-15-9-7-14(8-10-15)18-13-17(22)21-19(25-6-3)11-16(24-5-2)12-20(21)26-18/h7-13H,4-6H2,1-3H3 |
| InChIKey | CNIDYNUNQKUNAW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |