C25H26O5 — CID 131859007
5-hydroxy-7-(3-methylbut-2-enoxy)-2-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one (PubChem CID 131859007) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is 5-hydroxy-7-(3-methylbut-2-enoxy)-2-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one.
| Compound Name | 5-hydroxy-7-(3-methylbut-2-enoxy)-2-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 131859007 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-hydroxy-7-(3-methylbut-2-enoxy)-2-[4-(3-methylbut-2-enoxy)phenyl]chromen-4-one |
| SMILES | CC(C)=CCOc1ccc(-c2cc(=O)c3c(O)cc(OCC=C(C)C)cc3o2)cc1 |
| InChI | InChI=1S/C25H26O5/c1-16(2)9-11-28-19-7-5-18(6-8-19)23-15-22(27)25-21(26)13-20(14-24(25)30-23)29-12-10-17(3)4/h5-10,13-15,26H,11-12H2,1-4H3 |
| InChIKey | KYJGYOIYXPKMAM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|