C28H36N2O7 — CID 162668963
8-[2-[4-[3-(dimethylamino)propoxy]phenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-N-hydroxyoctanamide (PubChem CID 162668963) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is 8-[2-[4-[3-(dimethylamino)propoxy]phenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-N-hydroxyoctanamide.
| Compound Name | 8-[2-[4-[3-(dimethylamino)propoxy]phenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-N-hydroxyoctanamide |
|---|---|
| PubChem CID | 162668963 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 8-[2-[4-[3-(dimethylamino)propoxy]phenyl]-5-hydroxy-4-oxochromen-7-yl]oxy-N-hydroxyoctanamide |
| SMILES | CN(C)CCCOc1ccc(-c2cc(=O)c3c(O)cc(OCCCCCCCC(=O)NO)cc3o2)cc1 |
| InChI | InChI=1S/C28H36N2O7/c1-30(2)14-8-16-35-21-12-10-20(11-13-21)25-19-24(32)28-23(31)17-22(18-26(28)37-25)36-15-7-5-3-4-6-9-27(33)29-34/h10-13,17-19,31,34H,3-9,14-16H2,1-2H3,(H,29,33) |
| InChIKey | IMIKOWMYJWWGJS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|