C23H24O6 — CID 172994915
8-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoctanoic acid (PubChem CID 172994915) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 8-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoctanoic acid.
| Compound Name | 8-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoctanoic acid |
|---|---|
| PubChem CID | 172994915 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 8-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyoctanoic acid |
| SMILES | O=C(O)CCCCCCCOc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C23H24O6/c24-18-13-17(28-12-8-3-1-2-7-11-22(26)27)14-21-23(18)19(25)15-20(29-21)16-9-5-4-6-10-16/h4-6,9-10,13-15,24H,1-3,7-8,11-12H2,(H,26,27) |
| InChIKey | RYDUQXZXTSTUCG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|