C33H46O7 — CID 25173870
5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;octadecanoic acid (PubChem CID 25173870) has the molecular formula C33H46O7 and a molecular weight of 554.72 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;octadecanoic acid.
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;octadecanoic acid |
|---|---|
| PubChem CID | 25173870 |
| Molecular Formula | C33H46O7 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.O=c1cc(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C18H36O2.C15H10O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h2-17H2,1H3,(H,19,20);1-7,16-18H |
| InChIKey | NOULUIITGLGSIA-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|