C21H19BrO6 — CID 53486698
4-bromobutyl 2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyacetate (PubChem CID 53486698) has the molecular formula C21H19BrO6 and a molecular weight of 447.28 g/mol. Its IUPAC name is 4-bromobutyl 2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyacetate.
| Compound Name | 4-bromobutyl 2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 53486698 |
| Molecular Formula | C21H19BrO6 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 4-bromobutyl 2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxyacetate |
| SMILES | O=C(COc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1)OCCCCBr |
| InChI | InChI=1S/C21H19BrO6/c22-8-4-5-9-26-20(25)13-27-15-10-16(23)21-17(24)12-18(28-19(21)11-15)14-6-2-1-3-7-14/h1-3,6-7,10-12,23H,4-5,8-9,13H2 |
| InChIKey | ANHWBTSSEXUUPT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|