C27H34O5 — CID 132568297
7-hexoxy-2-(4-hexoxyphenyl)-5-hydroxychromen-4-one (PubChem CID 132568297) has the molecular formula C27H34O5 and a molecular weight of 438.56 g/mol. Its IUPAC name is 7-hexoxy-2-(4-hexoxyphenyl)-5-hydroxychromen-4-one.
| Compound Name | 7-hexoxy-2-(4-hexoxyphenyl)-5-hydroxychromen-4-one |
|---|---|
| PubChem CID | 132568297 |
| Molecular Formula | C27H34O5 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 7-hexoxy-2-(4-hexoxyphenyl)-5-hydroxychromen-4-one |
| SMILES | CCCCCCOc1ccc(-c2cc(=O)c3c(O)cc(OCCCCCC)cc3o2)cc1 |
| InChI | InChI=1S/C27H34O5/c1-3-5-7-9-15-30-21-13-11-20(12-14-21)25-19-24(29)27-23(28)17-22(18-26(27)32-25)31-16-10-8-6-4-2/h11-14,17-19,28H,3-10,15-16H2,1-2H3 |
| InChIKey | HONZCSRSWVMZRE-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|