C18H15NaO6 — CID 177001497
sodium 2-hydroxy-5-(5-hydroxy-4-oxo-7-propoxychromen-2-yl)phenolate (PubChem CID 177001497) has the molecular formula C18H15NaO6 and a molecular weight of 350.30 g/mol. Its IUPAC name is sodium 2-hydroxy-5-(5-hydroxy-4-oxo-7-propoxychromen-2-yl)phenolate.
| Compound Name | sodium 2-hydroxy-5-(5-hydroxy-4-oxo-7-propoxychromen-2-yl)phenolate |
|---|---|
| PubChem CID | 177001497 |
| Molecular Formula | C18H15NaO6 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | sodium 2-hydroxy-5-(5-hydroxy-4-oxo-7-propoxychromen-2-yl)phenolate |
| SMILES | CCCOc1cc(O)c2c(=O)cc(-c3ccc(O)c([O-])c3)oc2c1.[Na+] |
| InChI | InChI=1S/C18H16O6.Na/c1-2-5-23-11-7-14(21)18-15(22)9-16(24-17(18)8-11)10-3-4-12(19)13(20)6-10;/h3-4,6-9,19-21H,2,5H2,1H3;/q;+1/p-1 |
| InChIKey | QIUVTADPJGFFGJ-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |