About 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one
7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one (PubChem CID 19049226) has the molecular formula C22H24O8
and a molecular weight of 416.43 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one |
| PubChem CID | 19049226 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one |
| SMILES | CCCOc1cc(-c2cc(=O)c3c(O)cc(OCC(O)CO)cc3o2)ccc1OC |
| InChI | InChI=1S/C22H24O8/c1-3-6-28-20-7-13(4-5-18(20)27-2)19-10-17(26)22-16(25)8-15(9-21(22)30-19)29-12-14(24)11-23/h4-5,7-10,14,23-25H,3,6,11-12H2,1-2H3 |
| InChIKey | VIFGGTYBXAKJRB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one?
The IUPAC name of 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one (CID 19049226) is 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one.
What is the SMILES notation for 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one?
The canonical SMILES for 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one is CCCOc1cc(-c2cc(=O)c3c(O)cc(OCC(O)CO)cc3o2)ccc1OC.
What is the InChIKey of 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one?
The InChIKey is VIFGGTYBXAKJRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24O8/c1-3-6-28-20-7-13(4-5-18(20)27-2)19-10-17(26)22-16(25)8-15(9-21(22)30-19)29-12-14(24)11-23/h4-5,7-10,14,23-25H,3,6,11-12H2,1-2H3.
What are the key properties of 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one?
7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one has a molecular weight of 416.43 g/mol, XLogP of 2.69, 9 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,3-dihydroxypropoxy)-5-hydroxy-2-(4-methoxy-3-propoxyphenyl)chromen-4-one is sourced from PubChem (CID 19049226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).