C22H24O6 — CID 22376440
5-hydroxy-2-[3-hydroxy-4-(1-methoxypropan-2-yl)phenyl]-7-propoxychromen-4-one (PubChem CID 22376440) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 5-hydroxy-2-[3-hydroxy-4-(1-methoxypropan-2-yl)phenyl]-7-propoxychromen-4-one.
| Compound Name | 5-hydroxy-2-[3-hydroxy-4-(1-methoxypropan-2-yl)phenyl]-7-propoxychromen-4-one |
|---|---|
| PubChem CID | 22376440 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 5-hydroxy-2-[3-hydroxy-4-(1-methoxypropan-2-yl)phenyl]-7-propoxychromen-4-one |
| SMILES | CCCOc1cc(O)c2c(=O)cc(-c3ccc(C(C)COC)c(O)c3)oc2c1 |
| InChI | InChI=1S/C22H24O6/c1-4-7-27-15-9-18(24)22-19(25)11-20(28-21(22)10-15)14-5-6-16(17(23)8-14)13(2)12-26-3/h5-6,8-11,13,23-24H,4,7,12H2,1-3H3 |
| InChIKey | RZVOGKUHYCGICQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |