C19H17ClO4 — CID 177372719
7-chloro-5-hydroxy-2-[4-(2-methylpropoxy)phenyl]chromen-4-one (PubChem CID 177372719) has the molecular formula C19H17ClO4 and a molecular weight of 344.79 g/mol. Its IUPAC name is 7-chloro-5-hydroxy-2-[4-(2-methylpropoxy)phenyl]chromen-4-one.
| Compound Name | 7-chloro-5-hydroxy-2-[4-(2-methylpropoxy)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 177372719 |
| Molecular Formula | C19H17ClO4 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 7-chloro-5-hydroxy-2-[4-(2-methylpropoxy)phenyl]chromen-4-one |
| SMILES | CC(C)COc1ccc(-c2cc(=O)c3c(O)cc(Cl)cc3o2)cc1 |
| InChI | InChI=1S/C19H17ClO4/c1-11(2)10-23-14-5-3-12(4-6-14)17-9-16(22)19-15(21)7-13(20)8-18(19)24-17/h3-9,11,21H,10H2,1-2H3 |
| InChIKey | LIVCNFDFHAULDR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |