C37H26O7S6 — CID 86582075
5-hydroxy-7-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]-2-[4-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]phenyl]chromen-4-one (PubChem CID 86582075) has the molecular formula C37H26O7S6 and a molecular weight of 775.01 g/mol. Its IUPAC name is 5-hydroxy-7-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]-2-[4-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]phenyl]chromen-4-one.
| Compound Name | 5-hydroxy-7-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]-2-[4-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 86582075 |
| Molecular Formula | C37H26O7S6 |
| Molecular Weight | 775.01 g/mol |
| Exact Mass | 774.00 |
| IUPAC Name | 5-hydroxy-7-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]-2-[4-[2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]ethoxy]phenyl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(OCCOc3ccc(-c4cc(=S)ss4)cc3)cc2)oc2cc(OCCOc3ccc(-c4cc(=S)ss4)cc3)cc(O)c12 |
| InChI | InChI=1S/C37H26O7S6/c38-29-17-28(43-16-15-42-27-11-5-24(6-12-27)34-21-36(46)50-48-34)18-32-37(29)30(39)19-31(44-32)22-1-7-25(8-2-22)40-13-14-41-26-9-3-23(4-10-26)33-20-35(45)49-47-33/h1-12,17-21,38H,13-16H2 |
| InChIKey | CUUOWOABJFJFSX-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.01 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|