C43H44O14 — CID 24887162
5-hydroxy-2-[4-[2-[2-[2-[2-[4-[5-hydroxy-7-(methoxymethoxy)-4-oxo-1H-naphthalen-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-7-(methoxymethoxy)chromen-4-one (PubChem CID 24887162) has the molecular formula C43H44O14 and a molecular weight of 784.81 g/mol. Its IUPAC name is 5-hydroxy-2-[4-[2-[2-[2-[2-[4-[5-hydroxy-7-(methoxymethoxy)-4-oxo-1H-naphthalen-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-7-(methoxymethoxy)chromen-4-one.
| Compound Name | 5-hydroxy-2-[4-[2-[2-[2-[2-[4-[5-hydroxy-7-(methoxymethoxy)-4-oxo-1H-naphthalen-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-7-(methoxymethoxy)chromen-4-one |
|---|---|
| PubChem CID | 24887162 |
| Molecular Formula | C43H44O14 |
| Molecular Weight | 784.81 g/mol |
| Exact Mass | 784.27 |
| IUPAC Name | 5-hydroxy-2-[4-[2-[2-[2-[2-[4-[5-hydroxy-7-(methoxymethoxy)-4-oxo-1H-naphthalen-2-yl]phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]phenyl]-7-(methoxymethoxy)chromen-4-one |
| SMILES | COCOc1cc(O)c2c(c1)CC(c1ccc(OCCOCCOCCOCCOc3ccc(-c4cc(=O)c5c(O)cc(OCOC)cc5o4)cc3)cc1)=CC2=O |
| InChI | InChI=1S/C43H44O14/c1-48-26-55-34-20-31-19-30(21-36(44)42(31)37(45)22-34)28-3-7-32(8-4-28)53-17-15-51-13-11-50-12-14-52-16-18-54-33-9-5-29(6-10-33)40-25-39(47)43-38(46)23-35(56-27-49-2)24-41(43)57-40/h3-10,20-25,45-46H,11-19,26-27H2,1-2H3 |
| InChIKey | UXGQCPCWBDNUFW-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 170.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.81 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|